About 1-aminocyclobutane-1-carboxylate;4-methylbenzenesulfonate
1-aminocyclobutane-1-carboxylate;4-methylbenzenesulfonate (PubChem CID 22120946) has the molecular formula C12H15NO5S-2
and a molecular weight of 285.32 g/mol. Its IUPAC name is 1-aminocyclobutane-1-carboxylate;4-methylbenzenesulfonate.
Molecular Properties
| Compound Name | 1-aminocyclobutane-1-carboxylate;4-methylbenzenesulfonate |
| PubChem CID | 22120946 |
| Molecular Formula | C12H15NO5S-2 |
| Molecular Weight | 285.32 g/mol |
| Exact Mass | 285.07 |
| IUPAC Name | 1-aminocyclobutane-1-carboxylate;4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)[O-])cc1.NC1(C(=O)[O-])CCC1 |
| InChI | InChI=1S/C7H8O3S.C5H9NO2/c1-6-2-4-7(5-3-6)11(8,9)10;6-5(4(7)8)2-1-3-5/h2-5H,1H3,(H,8,9,10);1-3,6H2,(H,7,8)/p-2 |
| InChIKey | IJJGENXMFCJRPO-UHFFFAOYSA-L |
| XLogP | -0.48 |
| TPSA | 123.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.32 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 1-aminocyclobutane-1-carboxylate;4-methylbenzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-aminocyclobutane-1-carboxylate;4-methylbenzenesulfonate?
The IUPAC name of 1-aminocyclobutane-1-carboxylate;4-methylbenzenesulfonate (CID 22120946) is 1-aminocyclobutane-1-carboxylate;4-methylbenzenesulfonate.
What is the SMILES notation for 1-aminocyclobutane-1-carboxylate;4-methylbenzenesulfonate?
The canonical SMILES for 1-aminocyclobutane-1-carboxylate;4-methylbenzenesulfonate is Cc1ccc(S(=O)(=O)[O-])cc1.NC1(C(=O)[O-])CCC1.
What is the InChIKey of 1-aminocyclobutane-1-carboxylate;4-methylbenzenesulfonate?
The InChIKey is IJJGENXMFCJRPO-UHFFFAOYSA-L. The full InChI is InChI=1S/C7H8O3S.C5H9NO2/c1-6-2-4-7(5-3-6)11(8,9)10;6-5(4(7)8)2-1-3-5/h2-5H,1H3,(H,8,9,10);1-3,6H2,(H,7,8)/p-2.
What are the key properties of 1-aminocyclobutane-1-carboxylate;4-methylbenzenesulfonate?
1-aminocyclobutane-1-carboxylate;4-methylbenzenesulfonate has a molecular weight of 285.32 g/mol, XLogP of -0.48, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-aminocyclobutane-1-carboxylate;4-methylbenzenesulfonate is sourced from PubChem (CID 22120946), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).