C20H22O6S — CID 173344953
benzyl 3-formyloxy-3-methyl-2-(4-methylphenyl)sulfonylbutanoate (PubChem CID 173344953) has the molecular formula C20H22O6S and a molecular weight of 390.46 g/mol. Its IUPAC name is benzyl 3-formyloxy-3-methyl-2-(4-methylphenyl)sulfonylbutanoate.
| Compound Name | benzyl 3-formyloxy-3-methyl-2-(4-methylphenyl)sulfonylbutanoate |
|---|---|
| PubChem CID | 173344953 |
| Molecular Formula | C20H22O6S |
| Molecular Weight | 390.46 g/mol |
| Exact Mass | 390.11 |
| IUPAC Name | benzyl 3-formyloxy-3-methyl-2-(4-methylphenyl)sulfonylbutanoate |
| SMILES | Cc1ccc(S(=O)(=O)C(C(=O)OCc2ccccc2)C(C)(C)OC=O)cc1 |
| InChI | InChI=1S/C20H22O6S/c1-15-9-11-17(12-10-15)27(23,24)18(20(2,3)26-14-21)19(22)25-13-16-7-5-4-6-8-16/h4-12,14,18H,13H2,1-3H3 |
| InChIKey | TWBYXSIMWFCOCJ-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.46 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|