About benzyl 6-[(2S)-2-aminopropanoyl]oxyhexanoate;hydrochloride
benzyl 6-[(2S)-2-aminopropanoyl]oxyhexanoate;hydrochloride (PubChem CID 140857151) has the molecular formula C16H24ClNO4
and a molecular weight of 329.82 g/mol. Its IUPAC name is benzyl 6-[(2S)-2-aminopropanoyl]oxyhexanoate;hydrochloride.
Molecular Properties
| Compound Name | benzyl 6-[(2S)-2-aminopropanoyl]oxyhexanoate;hydrochloride |
| PubChem CID | 140857151 |
| Molecular Formula | C16H24ClNO4 |
| Molecular Weight | 329.82 g/mol |
| Exact Mass | 329.14 |
| IUPAC Name | benzyl 6-[(2S)-2-aminopropanoyl]oxyhexanoate;hydrochloride |
| SMILES | C[C@H](N)C(=O)OCCCCCC(=O)OCc1ccccc1.Cl |
| InChI | InChI=1S/C16H23NO4.ClH/c1-13(17)16(19)20-11-7-3-6-10-15(18)21-12-14-8-4-2-5-9-14;/h2,4-5,8-9,13H,3,6-7,10-12,17H2,1H3;1H/t13-;/m0./s1 |
| InChIKey | VDIXCKAUOQYMRU-ZOWNYOTGSA-N |
| XLogP | 2.60 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.82 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze benzyl 6-[(2S)-2-aminopropanoyl]oxyhexanoate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl 6-[(2S)-2-aminopropanoyl]oxyhexanoate;hydrochloride?
The IUPAC name of benzyl 6-[(2S)-2-aminopropanoyl]oxyhexanoate;hydrochloride (CID 140857151) is benzyl 6-[(2S)-2-aminopropanoyl]oxyhexanoate;hydrochloride.
What is the SMILES notation for benzyl 6-[(2S)-2-aminopropanoyl]oxyhexanoate;hydrochloride?
The canonical SMILES for benzyl 6-[(2S)-2-aminopropanoyl]oxyhexanoate;hydrochloride is C[C@H](N)C(=O)OCCCCCC(=O)OCc1ccccc1.Cl.
What is the InChIKey of benzyl 6-[(2S)-2-aminopropanoyl]oxyhexanoate;hydrochloride?
The InChIKey is VDIXCKAUOQYMRU-ZOWNYOTGSA-N. The full InChI is InChI=1S/C16H23NO4.ClH/c1-13(17)16(19)20-11-7-3-6-10-15(18)21-12-14-8-4-2-5-9-14;/h2,4-5,8-9,13H,3,6-7,10-12,17H2,1H3;1H/t13-;/m0./s1.
What are the key properties of benzyl 6-[(2S)-2-aminopropanoyl]oxyhexanoate;hydrochloride?
benzyl 6-[(2S)-2-aminopropanoyl]oxyhexanoate;hydrochloride has a molecular weight of 329.82 g/mol, XLogP of 2.60, 9 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl 6-[(2S)-2-aminopropanoyl]oxyhexanoate;hydrochloride is sourced from PubChem (CID 140857151), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).