C21H26Cl2N6O4S — CID 10143131
(2S)-N-[(2S)-1-amino-1-oxo-3-phenylpropan-2-yl]-5-(diaminomethylideneamino)-2-[(2,5-dichlorophenyl)sulfonylamino]pentanamide (PubChem CID 10143131) has the molecular formula C21H26Cl2N6O4S and a molecular weight of 529.45 g/mol. Its IUPAC name is (2S)-N-[(2S)-1-amino-1-oxo-3-phenylpropan-2-yl]-5-(diaminomethylideneamino)-2-[(2,5-dichlorophenyl)sulfonylamino]pentanamide.
| Compound Name | (2S)-N-[(2S)-1-amino-1-oxo-3-phenylpropan-2-yl]-5-(diaminomethylideneamino)-2-[(2,5-dichlorophenyl)sulfonylamino]pentanamide |
|---|---|
| PubChem CID | 10143131 |
| Molecular Formula | C21H26Cl2N6O4S |
| Molecular Weight | 529.45 g/mol |
| Exact Mass | 528.11 |
| IUPAC Name | (2S)-N-[(2S)-1-amino-1-oxo-3-phenylpropan-2-yl]-5-(diaminomethylideneamino)-2-[(2,5-dichlorophenyl)sulfonylamino]pentanamide |
| SMILES | NC(=O)[C@H](Cc1ccccc1)NC(=O)[C@H](CCCN=C(N)N)NS(=O)(=O)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C21H26Cl2N6O4S/c22-14-8-9-15(23)18(12-14)34(32,33)29-16(7-4-10-27-21(25)26)20(31)28-17(19(24)30)11-13-5-2-1-3-6-13/h1-3,5-6,8-9,12,16-17,29H,4,7,10-11H2,(H2,24,30)(H,28,31)(H4,25,26,27)/t16-,17-/m0/s1 |
| InChIKey | GKLLRBSAKYGLGL-IRXDYDNUSA-N |
| XLogP | 0.91 |
| TPSA | 182.76 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.45 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|