C19H23ClN2O — CID 54380002
N'-[2-[(3-chlorophenyl)methoxy]propyl]-2-(3-methylphenyl)ethanimidamide (PubChem CID 54380002) has the molecular formula C19H23ClN2O and a molecular weight of 330.86 g/mol. Its IUPAC name is N'-[2-[(3-chlorophenyl)methoxy]propyl]-2-(3-methylphenyl)ethanimidamide.
| Compound Name | N'-[2-[(3-chlorophenyl)methoxy]propyl]-2-(3-methylphenyl)ethanimidamide |
|---|---|
| PubChem CID | 54380002 |
| Molecular Formula | C19H23ClN2O |
| Molecular Weight | 330.86 g/mol |
| Exact Mass | 330.15 |
| IUPAC Name | N'-[2-[(3-chlorophenyl)methoxy]propyl]-2-(3-methylphenyl)ethanimidamide |
| SMILES | Cc1cccc(C/C(N)=N/CC(C)OCc2cccc(Cl)c2)c1 |
| InChI | InChI=1S/C19H23ClN2O/c1-14-5-3-6-16(9-14)11-19(21)22-12-15(2)23-13-17-7-4-8-18(20)10-17/h3-10,15H,11-13H2,1-2H3,(H2,21,22) |
| InChIKey | UZFXTIRNVVIBLO-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.86 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|