C11H16FN3O — CID 62542673
N-amino-2-(3-fluorophenyl)-N'-(2-methoxyethyl)ethanimidamide (PubChem CID 62542673) has the molecular formula C11H16FN3O and a molecular weight of 225.27 g/mol. Its IUPAC name is N-amino-2-(3-fluorophenyl)-N'-(2-methoxyethyl)ethanimidamide.
| Compound Name | N-amino-2-(3-fluorophenyl)-N'-(2-methoxyethyl)ethanimidamide |
|---|---|
| PubChem CID | 62542673 |
| Molecular Formula | C11H16FN3O |
| Molecular Weight | 225.27 g/mol |
| Exact Mass | 225.13 |
| IUPAC Name | N-amino-2-(3-fluorophenyl)-N'-(2-methoxyethyl)ethanimidamide |
| SMILES | COCC/N=C(/Cc1cccc(F)c1)NN |
| InChI | InChI=1S/C11H16FN3O/c1-16-6-5-14-11(15-13)8-9-3-2-4-10(12)7-9/h2-4,7H,5-6,8,13H2,1H3,(H,14,15) |
| InChIKey | FQTZKOXNQFFKHE-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 59.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.27 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|