C22H21ClF3NO3 — CID 3625259
[2-[4-chloro-2-(trifluoromethyl)anilino]-2-oxo-1-phenylethyl] cyclohexanecarboxylate (PubChem CID 3625259) has the molecular formula C22H21ClF3NO3 and a molecular weight of 439.86 g/mol. Its IUPAC name is [2-[4-chloro-2-(trifluoromethyl)anilino]-2-oxo-1-phenylethyl] cyclohexanecarboxylate.
| Compound Name | [2-[4-chloro-2-(trifluoromethyl)anilino]-2-oxo-1-phenylethyl] cyclohexanecarboxylate |
|---|---|
| PubChem CID | 3625259 |
| Molecular Formula | C22H21ClF3NO3 |
| Molecular Weight | 439.86 g/mol |
| Exact Mass | 439.12 |
| IUPAC Name | [2-[4-chloro-2-(trifluoromethyl)anilino]-2-oxo-1-phenylethyl] cyclohexanecarboxylate |
| SMILES | O=C(OC(C(=O)Nc1ccc(Cl)cc1C(F)(F)F)c1ccccc1)C1CCCCC1 |
| InChI | InChI=1S/C22H21ClF3NO3/c23-16-11-12-18(17(13-16)22(24,25)26)27-20(28)19(14-7-3-1-4-8-14)30-21(29)15-9-5-2-6-10-15/h1,3-4,7-8,11-13,15,19H,2,5-6,9-10H2,(H,27,28) |
| InChIKey | NHSJQZDZBOYYPE-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.86 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |