C20H23FN2O — CID 40632646
(2S)-2-(cyclohexylamino)-N-(4-fluorophenyl)-2-phenylacetamide (PubChem CID 40632646) has the molecular formula C20H23FN2O and a molecular weight of 326.42 g/mol. Its IUPAC name is (2S)-2-(cyclohexylamino)-N-(4-fluorophenyl)-2-phenylacetamide.
| Compound Name | (2S)-2-(cyclohexylamino)-N-(4-fluorophenyl)-2-phenylacetamide |
|---|---|
| PubChem CID | 40632646 |
| Molecular Formula | C20H23FN2O |
| Molecular Weight | 326.42 g/mol |
| Exact Mass | 326.18 |
| IUPAC Name | (2S)-2-(cyclohexylamino)-N-(4-fluorophenyl)-2-phenylacetamide |
| SMILES | O=C(Nc1ccc(F)cc1)[C@@H](NC1CCCCC1)c1ccccc1 |
| InChI | InChI=1S/C20H23FN2O/c21-16-11-13-18(14-12-16)23-20(24)19(15-7-3-1-4-8-15)22-17-9-5-2-6-10-17/h1,3-4,7-8,11-14,17,19,22H,2,5-6,9-10H2,(H,23,24)/t19-/m0/s1 |
| InChIKey | AVCFCIONZNYWDA-IBGZPJMESA-N |
| XLogP | 4.43 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.42 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |