C22H19Cl2FN2O3 — CID 4637279
[1-(2,4-dichloroanilino)-1-oxopropan-2-yl] 1-(4-fluorophenyl)-2,5-dimethylpyrrole-3-carboxylate (PubChem CID 4637279) has the molecular formula C22H19Cl2FN2O3 and a molecular weight of 449.31 g/mol. Its IUPAC name is [1-(2,4-dichloroanilino)-1-oxopropan-2-yl] 1-(4-fluorophenyl)-2,5-dimethylpyrrole-3-carboxylate.
| Compound Name | [1-(2,4-dichloroanilino)-1-oxopropan-2-yl] 1-(4-fluorophenyl)-2,5-dimethylpyrrole-3-carboxylate |
|---|---|
| PubChem CID | 4637279 |
| Molecular Formula | C22H19Cl2FN2O3 |
| Molecular Weight | 449.31 g/mol |
| Exact Mass | 448.08 |
| IUPAC Name | [1-(2,4-dichloroanilino)-1-oxopropan-2-yl] 1-(4-fluorophenyl)-2,5-dimethylpyrrole-3-carboxylate |
| SMILES | Cc1cc(C(=O)OC(C)C(=O)Nc2ccc(Cl)cc2Cl)c(C)n1-c1ccc(F)cc1 |
| InChI | InChI=1S/C22H19Cl2FN2O3/c1-12-10-18(13(2)27(12)17-7-5-16(25)6-8-17)22(29)30-14(3)21(28)26-20-9-4-15(23)11-19(20)24/h4-11,14H,1-3H3,(H,26,28) |
| InChIKey | MAEODYBWMZITOC-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 60.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.31 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|