C21H29N5O3S — CID 78905603
N-[3-[(1-methylazepan-2-ylidene)amino]sulfonylphenyl]-5-(2-methylpropyl)-1H-pyrazole-3-carboxamide (PubChem CID 78905603) has the molecular formula C21H29N5O3S and a molecular weight of 431.56 g/mol. Its IUPAC name is N-[3-[(1-methylazepan-2-ylidene)amino]sulfonylphenyl]-5-(2-methylpropyl)-1H-pyrazole-3-carboxamide.
| Compound Name | N-[3-[(1-methylazepan-2-ylidene)amino]sulfonylphenyl]-5-(2-methylpropyl)-1H-pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 78905603 |
| Molecular Formula | C21H29N5O3S |
| Molecular Weight | 431.56 g/mol |
| Exact Mass | 431.20 |
| IUPAC Name | N-[3-[(1-methylazepan-2-ylidene)amino]sulfonylphenyl]-5-(2-methylpropyl)-1H-pyrazole-3-carboxamide |
| SMILES | CC(C)Cc1cc(C(=O)Nc2cccc(S(=O)(=O)N=C3CCCCCN3C)c2)n[nH]1 |
| InChI | InChI=1S/C21H29N5O3S/c1-15(2)12-17-14-19(24-23-17)21(27)22-16-8-7-9-18(13-16)30(28,29)25-20-10-5-4-6-11-26(20)3/h7-9,13-15H,4-6,10-12H2,1-3H3,(H,22,27)(H,23,24) |
| InChIKey | ATRYYYSORDSJMG-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 107.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.56 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|