C23H24N4O3S — CID 76867418
N-[3-[(1-methylazepan-2-ylidene)amino]sulfonylphenyl]quinoline-4-carboxamide (PubChem CID 76867418) has the molecular formula C23H24N4O3S and a molecular weight of 436.54 g/mol. Its IUPAC name is N-[3-[(1-methylazepan-2-ylidene)amino]sulfonylphenyl]quinoline-4-carboxamide.
| Compound Name | N-[3-[(1-methylazepan-2-ylidene)amino]sulfonylphenyl]quinoline-4-carboxamide |
|---|---|
| PubChem CID | 76867418 |
| Molecular Formula | C23H24N4O3S |
| Molecular Weight | 436.54 g/mol |
| Exact Mass | 436.16 |
| IUPAC Name | N-[3-[(1-methylazepan-2-ylidene)amino]sulfonylphenyl]quinoline-4-carboxamide |
| SMILES | CN1CCCCCC1=NS(=O)(=O)c1cccc(NC(=O)c2ccnc3ccccc23)c1 |
| InChI | InChI=1S/C23H24N4O3S/c1-27-15-6-2-3-12-22(27)26-31(29,30)18-9-7-8-17(16-18)25-23(28)20-13-14-24-21-11-5-4-10-19(20)21/h4-5,7-11,13-14,16H,2-3,6,12,15H2,1H3,(H,25,28) |
| InChIKey | NRZYXNZKJFANCR-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 91.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.54 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|