C18H18ClF2N3O3S — CID 34071219
2-chloro-4,5-difluoro-N-[4-(4-methylpiperazin-1-yl)sulfonylphenyl]benzamide (PubChem CID 34071219) has the molecular formula C18H18ClF2N3O3S and a molecular weight of 429.88 g/mol. Its IUPAC name is 2-chloro-4,5-difluoro-N-[4-(4-methylpiperazin-1-yl)sulfonylphenyl]benzamide.
| Compound Name | 2-chloro-4,5-difluoro-N-[4-(4-methylpiperazin-1-yl)sulfonylphenyl]benzamide |
|---|---|
| PubChem CID | 34071219 |
| Molecular Formula | C18H18ClF2N3O3S |
| Molecular Weight | 429.88 g/mol |
| Exact Mass | 429.07 |
| IUPAC Name | 2-chloro-4,5-difluoro-N-[4-(4-methylpiperazin-1-yl)sulfonylphenyl]benzamide |
| SMILES | CN1CCN(S(=O)(=O)c2ccc(NC(=O)c3cc(F)c(F)cc3Cl)cc2)CC1 |
| InChI | InChI=1S/C18H18ClF2N3O3S/c1-23-6-8-24(9-7-23)28(26,27)13-4-2-12(3-5-13)22-18(25)14-10-16(20)17(21)11-15(14)19/h2-5,10-11H,6-9H2,1H3,(H,22,25) |
| InChIKey | YRWXACREYPGAJA-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.88 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|