C19H22BrN3OS — CID 76869924
3-(5-bromothiophen-2-yl)-N-[3-[(4-methylpiperazin-1-yl)methyl]phenyl]prop-2-enamide (PubChem CID 76869924) has the molecular formula C19H22BrN3OS and a molecular weight of 420.38 g/mol. Its IUPAC name is 3-(5-bromothiophen-2-yl)-N-[3-[(4-methylpiperazin-1-yl)methyl]phenyl]prop-2-enamide.
| Compound Name | 3-(5-bromothiophen-2-yl)-N-[3-[(4-methylpiperazin-1-yl)methyl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 76869924 |
| Molecular Formula | C19H22BrN3OS |
| Molecular Weight | 420.38 g/mol |
| Exact Mass | 419.07 |
| IUPAC Name | 3-(5-bromothiophen-2-yl)-N-[3-[(4-methylpiperazin-1-yl)methyl]phenyl]prop-2-enamide |
| SMILES | CN1CCN(Cc2cccc(NC(=O)C=Cc3ccc(Br)s3)c2)CC1 |
| InChI | InChI=1S/C19H22BrN3OS/c1-22-9-11-23(12-10-22)14-15-3-2-4-16(13-15)21-19(24)8-6-17-5-7-18(20)25-17/h2-8,13H,9-12,14H2,1H3,(H,21,24) |
| InChIKey | LWHDLFFLVPGVHO-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.38 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|