C22H25N5O4S — CID 55880367
4-(cyclopropylcarbamoylamino)-N-[3-[(1-methylpyrrolidin-2-ylidene)amino]sulfonylphenyl]benzamide (PubChem CID 55880367) has the molecular formula C22H25N5O4S and a molecular weight of 455.54 g/mol. Its IUPAC name is 4-(cyclopropylcarbamoylamino)-N-[3-[(1-methylpyrrolidin-2-ylidene)amino]sulfonylphenyl]benzamide.
| Compound Name | 4-(cyclopropylcarbamoylamino)-N-[3-[(1-methylpyrrolidin-2-ylidene)amino]sulfonylphenyl]benzamide |
|---|---|
| PubChem CID | 55880367 |
| Molecular Formula | C22H25N5O4S |
| Molecular Weight | 455.54 g/mol |
| Exact Mass | 455.16 |
| IUPAC Name | 4-(cyclopropylcarbamoylamino)-N-[3-[(1-methylpyrrolidin-2-ylidene)amino]sulfonylphenyl]benzamide |
| SMILES | CN1CCCC1=NS(=O)(=O)c1cccc(NC(=O)c2ccc(NC(=O)NC3CC3)cc2)c1 |
| InChI | InChI=1S/C22H25N5O4S/c1-27-13-3-6-20(27)26-32(30,31)19-5-2-4-18(14-19)23-21(28)15-7-9-16(10-8-15)24-22(29)25-17-11-12-17/h2,4-5,7-10,14,17H,3,6,11-13H2,1H3,(H,23,28)(H2,24,25,29) |
| InChIKey | VVTNQGUQOTXESA-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 119.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.54 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|