C22H18ClN3O3S — CID 26720242
N-[3-[(2-chlorophenyl)sulfamoyl]phenyl]-2-methyl-1H-indole-3-carboxamide (PubChem CID 26720242) has the molecular formula C22H18ClN3O3S and a molecular weight of 439.92 g/mol. Its IUPAC name is N-[3-[(2-chlorophenyl)sulfamoyl]phenyl]-2-methyl-1H-indole-3-carboxamide.
| Compound Name | N-[3-[(2-chlorophenyl)sulfamoyl]phenyl]-2-methyl-1H-indole-3-carboxamide |
|---|---|
| PubChem CID | 26720242 |
| Molecular Formula | C22H18ClN3O3S |
| Molecular Weight | 439.92 g/mol |
| Exact Mass | 439.08 |
| IUPAC Name | N-[3-[(2-chlorophenyl)sulfamoyl]phenyl]-2-methyl-1H-indole-3-carboxamide |
| SMILES | Cc1[nH]c2ccccc2c1C(=O)Nc1cccc(S(=O)(=O)Nc2ccccc2Cl)c1 |
| InChI | InChI=1S/C22H18ClN3O3S/c1-14-21(17-9-2-4-11-19(17)24-14)22(27)25-15-7-6-8-16(13-15)30(28,29)26-20-12-5-3-10-18(20)23/h2-13,24,26H,1H3,(H,25,27) |
| InChIKey | VPMYUNLAXIQQMZ-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 91.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.92 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |