C22H24N4O5S — CID 55919935
N-[3-[(Z)-(1-methylazepan-2-ylidene)amino]sulfonylphenyl]-3-oxo-4H-1,4-benzoxazine-6-carboxamide (PubChem CID 55919935) has the molecular formula C22H24N4O5S and a molecular weight of 456.52 g/mol. Its IUPAC name is N-[3-[(Z)-(1-methylazepan-2-ylidene)amino]sulfonylphenyl]-3-oxo-4H-1,4-benzoxazine-6-carboxamide.
| Compound Name | N-[3-[(Z)-(1-methylazepan-2-ylidene)amino]sulfonylphenyl]-3-oxo-4H-1,4-benzoxazine-6-carboxamide |
|---|---|
| PubChem CID | 55919935 |
| Molecular Formula | C22H24N4O5S |
| Molecular Weight | 456.52 g/mol |
| Exact Mass | 456.15 |
| IUPAC Name | N-[3-[(Z)-(1-methylazepan-2-ylidene)amino]sulfonylphenyl]-3-oxo-4H-1,4-benzoxazine-6-carboxamide |
| SMILES | CN1CCCCC/C1=N/S(=O)(=O)c1cccc(NC(=O)c2ccc3c(c2)NC(=O)CO3)c1 |
| InChI | InChI=1S/C22H24N4O5S/c1-26-11-4-2-3-8-20(26)25-32(29,30)17-7-5-6-16(13-17)23-22(28)15-9-10-19-18(12-15)24-21(27)14-31-19/h5-7,9-10,12-13H,2-4,8,11,14H2,1H3,(H,23,28)(H,24,27)/b25-20- |
| InChIKey | CUHYGWJXIWKOKH-QQTULTPQSA-N |
| XLogP | 2.86 |
| TPSA | 117.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.52 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|