C24H26N4O4S — CID 60530520
3-[5-(4-methylphenyl)-1,3-oxazol-2-yl]-N-[3-[(E)-(1-methylpyrrolidin-2-ylidene)amino]sulfonylphenyl]propanamide (PubChem CID 60530520) has the molecular formula C24H26N4O4S and a molecular weight of 466.56 g/mol. Its IUPAC name is 3-[5-(4-methylphenyl)-1,3-oxazol-2-yl]-N-[3-[(E)-(1-methylpyrrolidin-2-ylidene)amino]sulfonylphenyl]propanamide.
| Compound Name | 3-[5-(4-methylphenyl)-1,3-oxazol-2-yl]-N-[3-[(E)-(1-methylpyrrolidin-2-ylidene)amino]sulfonylphenyl]propanamide |
|---|---|
| PubChem CID | 60530520 |
| Molecular Formula | C24H26N4O4S |
| Molecular Weight | 466.56 g/mol |
| Exact Mass | 466.17 |
| IUPAC Name | 3-[5-(4-methylphenyl)-1,3-oxazol-2-yl]-N-[3-[(E)-(1-methylpyrrolidin-2-ylidene)amino]sulfonylphenyl]propanamide |
| SMILES | Cc1ccc(-c2cnc(CCC(=O)Nc3cccc(S(=O)(=O)/N=C4\CCCN4C)c3)o2)cc1 |
| InChI | InChI=1S/C24H26N4O4S/c1-17-8-10-18(11-9-17)21-16-25-24(32-21)13-12-23(29)26-19-5-3-6-20(15-19)33(30,31)27-22-7-4-14-28(22)2/h3,5-6,8-11,15-16H,4,7,12-14H2,1-2H3,(H,26,29)/b27-22+ |
| InChIKey | QTQSOSLYKRMAGN-HPNDGRJYSA-N |
| XLogP | 4.03 |
| TPSA | 104.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.56 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|