C21H22ClN3O5S2 — CID 55541960
N-[4-chloro-3-(diethylsulfamoyl)phenyl]-3-[(2,4-dioxo-1,3-thiazolidin-3-yl)methyl]benzamide (PubChem CID 55541960) has the molecular formula C21H22ClN3O5S2 and a molecular weight of 496.01 g/mol. Its IUPAC name is N-[4-chloro-3-(diethylsulfamoyl)phenyl]-3-[(2,4-dioxo-1,3-thiazolidin-3-yl)methyl]benzamide.
| Compound Name | N-[4-chloro-3-(diethylsulfamoyl)phenyl]-3-[(2,4-dioxo-1,3-thiazolidin-3-yl)methyl]benzamide |
|---|---|
| PubChem CID | 55541960 |
| Molecular Formula | C21H22ClN3O5S2 |
| Molecular Weight | 496.01 g/mol |
| Exact Mass | 495.07 |
| IUPAC Name | N-[4-chloro-3-(diethylsulfamoyl)phenyl]-3-[(2,4-dioxo-1,3-thiazolidin-3-yl)methyl]benzamide |
| SMILES | CCN(CC)S(=O)(=O)c1cc(NC(=O)c2cccc(CN3C(=O)CSC3=O)c2)ccc1Cl |
| InChI | InChI=1S/C21H22ClN3O5S2/c1-3-24(4-2)32(29,30)18-11-16(8-9-17(18)22)23-20(27)15-7-5-6-14(10-15)12-25-19(26)13-31-21(25)28/h5-11H,3-4,12-13H2,1-2H3,(H,23,27) |
| InChIKey | JEEFCMPDTJNISG-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 103.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.01 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|