C17H12ClFN2O3S — CID 55542286
N-(2-chloro-4-fluorophenyl)-3-[(2,4-dioxo-1,3-thiazolidin-3-yl)methyl]benzamide (PubChem CID 55542286) has the molecular formula C17H12ClFN2O3S and a molecular weight of 378.81 g/mol. Its IUPAC name is N-(2-chloro-4-fluorophenyl)-3-[(2,4-dioxo-1,3-thiazolidin-3-yl)methyl]benzamide.
| Compound Name | N-(2-chloro-4-fluorophenyl)-3-[(2,4-dioxo-1,3-thiazolidin-3-yl)methyl]benzamide |
|---|---|
| PubChem CID | 55542286 |
| Molecular Formula | C17H12ClFN2O3S |
| Molecular Weight | 378.81 g/mol |
| Exact Mass | 378.02 |
| IUPAC Name | N-(2-chloro-4-fluorophenyl)-3-[(2,4-dioxo-1,3-thiazolidin-3-yl)methyl]benzamide |
| SMILES | O=C(Nc1ccc(F)cc1Cl)c1cccc(CN2C(=O)CSC2=O)c1 |
| InChI | InChI=1S/C17H12ClFN2O3S/c18-13-7-12(19)4-5-14(13)20-16(23)11-3-1-2-10(6-11)8-21-15(22)9-25-17(21)24/h1-7H,8-9H2,(H,20,23) |
| InChIKey | ZCSYWDJPAUFBRE-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.81 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|