C22H24N4O5S2 — CID 55531368
3-[(2,4-dioxo-1,3-thiazolidin-3-yl)methyl]-N-[4-(4-methylpiperazin-1-yl)sulfonylphenyl]benzamide (PubChem CID 55531368) has the molecular formula C22H24N4O5S2 and a molecular weight of 488.59 g/mol. Its IUPAC name is 3-[(2,4-dioxo-1,3-thiazolidin-3-yl)methyl]-N-[4-(4-methylpiperazin-1-yl)sulfonylphenyl]benzamide.
| Compound Name | 3-[(2,4-dioxo-1,3-thiazolidin-3-yl)methyl]-N-[4-(4-methylpiperazin-1-yl)sulfonylphenyl]benzamide |
|---|---|
| PubChem CID | 55531368 |
| Molecular Formula | C22H24N4O5S2 |
| Molecular Weight | 488.59 g/mol |
| Exact Mass | 488.12 |
| IUPAC Name | 3-[(2,4-dioxo-1,3-thiazolidin-3-yl)methyl]-N-[4-(4-methylpiperazin-1-yl)sulfonylphenyl]benzamide |
| SMILES | CN1CCN(S(=O)(=O)c2ccc(NC(=O)c3cccc(CN4C(=O)CSC4=O)c3)cc2)CC1 |
| InChI | InChI=1S/C22H24N4O5S2/c1-24-9-11-25(12-10-24)33(30,31)19-7-5-18(6-8-19)23-21(28)17-4-2-3-16(13-17)14-26-20(27)15-32-22(26)29/h2-8,13H,9-12,14-15H2,1H3,(H,23,28) |
| InChIKey | NDUKCXWHQAGEHS-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 107.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.59 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|