C22H22N2O5S2 — CID 55611099
N-(4-cyclopentylsulfonylphenyl)-3-[(2,4-dioxo-1,3-thiazolidin-3-yl)methyl]benzamide (PubChem CID 55611099) has the molecular formula C22H22N2O5S2 and a molecular weight of 458.56 g/mol. Its IUPAC name is N-(4-cyclopentylsulfonylphenyl)-3-[(2,4-dioxo-1,3-thiazolidin-3-yl)methyl]benzamide.
| Compound Name | N-(4-cyclopentylsulfonylphenyl)-3-[(2,4-dioxo-1,3-thiazolidin-3-yl)methyl]benzamide |
|---|---|
| PubChem CID | 55611099 |
| Molecular Formula | C22H22N2O5S2 |
| Molecular Weight | 458.56 g/mol |
| Exact Mass | 458.10 |
| IUPAC Name | N-(4-cyclopentylsulfonylphenyl)-3-[(2,4-dioxo-1,3-thiazolidin-3-yl)methyl]benzamide |
| SMILES | O=C(Nc1ccc(S(=O)(=O)C2CCCC2)cc1)c1cccc(CN2C(=O)CSC2=O)c1 |
| InChI | InChI=1S/C22H22N2O5S2/c25-20-14-30-22(27)24(20)13-15-4-3-5-16(12-15)21(26)23-17-8-10-19(11-9-17)31(28,29)18-6-1-2-7-18/h3-5,8-12,18H,1-2,6-7,13-14H2,(H,23,26) |
| InChIKey | BILJUTXLJYTFRT-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.56 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|