C21H21N3O6S2 — CID 55547898
N-[5-(cyclopropylsulfamoyl)-2-methoxyphenyl]-3-[(2,4-dioxo-1,3-thiazolidin-3-yl)methyl]benzamide (PubChem CID 55547898) has the molecular formula C21H21N3O6S2 and a molecular weight of 475.55 g/mol. Its IUPAC name is N-[5-(cyclopropylsulfamoyl)-2-methoxyphenyl]-3-[(2,4-dioxo-1,3-thiazolidin-3-yl)methyl]benzamide.
| Compound Name | N-[5-(cyclopropylsulfamoyl)-2-methoxyphenyl]-3-[(2,4-dioxo-1,3-thiazolidin-3-yl)methyl]benzamide |
|---|---|
| PubChem CID | 55547898 |
| Molecular Formula | C21H21N3O6S2 |
| Molecular Weight | 475.55 g/mol |
| Exact Mass | 475.09 |
| IUPAC Name | N-[5-(cyclopropylsulfamoyl)-2-methoxyphenyl]-3-[(2,4-dioxo-1,3-thiazolidin-3-yl)methyl]benzamide |
| SMILES | COc1ccc(S(=O)(=O)NC2CC2)cc1NC(=O)c1cccc(CN2C(=O)CSC2=O)c1 |
| InChI | InChI=1S/C21H21N3O6S2/c1-30-18-8-7-16(32(28,29)23-15-5-6-15)10-17(18)22-20(26)14-4-2-3-13(9-14)11-24-19(25)12-31-21(24)27/h2-4,7-10,15,23H,5-6,11-12H2,1H3,(H,22,26) |
| InChIKey | IVNQSWDWJBFFSE-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 121.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.55 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|