C17H19N3O5S — CID 55574013
N-[5-(cyclopropylsulfamoyl)-2-methoxyphenyl]-1-methyl-2-oxopyridine-4-carboxamide (PubChem CID 55574013) has the molecular formula C17H19N3O5S and a molecular weight of 377.42 g/mol. Its IUPAC name is N-[5-(cyclopropylsulfamoyl)-2-methoxyphenyl]-1-methyl-2-oxopyridine-4-carboxamide.
| Compound Name | N-[5-(cyclopropylsulfamoyl)-2-methoxyphenyl]-1-methyl-2-oxopyridine-4-carboxamide |
|---|---|
| PubChem CID | 55574013 |
| Molecular Formula | C17H19N3O5S |
| Molecular Weight | 377.42 g/mol |
| Exact Mass | 377.10 |
| IUPAC Name | N-[5-(cyclopropylsulfamoyl)-2-methoxyphenyl]-1-methyl-2-oxopyridine-4-carboxamide |
| SMILES | COc1ccc(S(=O)(=O)NC2CC2)cc1NC(=O)c1ccn(C)c(=O)c1 |
| InChI | InChI=1S/C17H19N3O5S/c1-20-8-7-11(9-16(20)21)17(22)18-14-10-13(5-6-15(14)25-2)26(23,24)19-12-3-4-12/h5-10,12,19H,3-4H2,1-2H3,(H,18,22) |
| InChIKey | OCJYSYHDBSFVJP-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 106.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.42 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |