C19H23N3O4S — CID 33159367
N-[5-(cyclopropylsulfamoyl)-2-methoxyphenyl]-3-(dimethylamino)benzamide (PubChem CID 33159367) has the molecular formula C19H23N3O4S and a molecular weight of 389.48 g/mol. Its IUPAC name is N-[5-(cyclopropylsulfamoyl)-2-methoxyphenyl]-3-(dimethylamino)benzamide.
| Compound Name | N-[5-(cyclopropylsulfamoyl)-2-methoxyphenyl]-3-(dimethylamino)benzamide |
|---|---|
| PubChem CID | 33159367 |
| Molecular Formula | C19H23N3O4S |
| Molecular Weight | 389.48 g/mol |
| Exact Mass | 389.14 |
| IUPAC Name | N-[5-(cyclopropylsulfamoyl)-2-methoxyphenyl]-3-(dimethylamino)benzamide |
| SMILES | COc1ccc(S(=O)(=O)NC2CC2)cc1NC(=O)c1cccc(N(C)C)c1 |
| InChI | InChI=1S/C19H23N3O4S/c1-22(2)15-6-4-5-13(11-15)19(23)20-17-12-16(9-10-18(17)26-3)27(24,25)21-14-7-8-14/h4-6,9-12,14,21H,7-8H2,1-3H3,(H,20,23) |
| InChIKey | BTSJMWJVPFMMEQ-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.48 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |