C23H23ClN4O4S — CID 55630897
N-[3-[[4-chloro-3-(diethylsulfamoyl)phenyl]carbamoyl]phenyl]pyridine-3-carboxamide (PubChem CID 55630897) has the molecular formula C23H23ClN4O4S and a molecular weight of 486.98 g/mol. Its IUPAC name is N-[3-[[4-chloro-3-(diethylsulfamoyl)phenyl]carbamoyl]phenyl]pyridine-3-carboxamide.
| Compound Name | N-[3-[[4-chloro-3-(diethylsulfamoyl)phenyl]carbamoyl]phenyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 55630897 |
| Molecular Formula | C23H23ClN4O4S |
| Molecular Weight | 486.98 g/mol |
| Exact Mass | 486.11 |
| IUPAC Name | N-[3-[[4-chloro-3-(diethylsulfamoyl)phenyl]carbamoyl]phenyl]pyridine-3-carboxamide |
| SMILES | CCN(CC)S(=O)(=O)c1cc(NC(=O)c2cccc(NC(=O)c3cccnc3)c2)ccc1Cl |
| InChI | InChI=1S/C23H23ClN4O4S/c1-3-28(4-2)33(31,32)21-14-19(10-11-20(21)24)27-22(29)16-7-5-9-18(13-16)26-23(30)17-8-6-12-25-15-17/h5-15H,3-4H2,1-2H3,(H,26,30)(H,27,29) |
| InChIKey | RTYPXEGQGPDVJE-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 108.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.98 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |