C21H20Cl2F2N2O4 — CID 34169888
(E)-N-[2-(2,6-dichloroanilino)-2-oxoethyl]-3-[4-(difluoromethoxy)-3-methoxyphenyl]-N-ethylprop-2-enamide (PubChem CID 34169888) has the molecular formula C21H20Cl2F2N2O4 and a molecular weight of 473.30 g/mol. Its IUPAC name is (E)-N-[2-(2,6-dichloroanilino)-2-oxoethyl]-3-[4-(difluoromethoxy)-3-methoxyphenyl]-N-ethylprop-2-enamide.
| Compound Name | (E)-N-[2-(2,6-dichloroanilino)-2-oxoethyl]-3-[4-(difluoromethoxy)-3-methoxyphenyl]-N-ethylprop-2-enamide |
|---|---|
| PubChem CID | 34169888 |
| Molecular Formula | C21H20Cl2F2N2O4 |
| Molecular Weight | 473.30 g/mol |
| Exact Mass | 472.08 |
| IUPAC Name | (E)-N-[2-(2,6-dichloroanilino)-2-oxoethyl]-3-[4-(difluoromethoxy)-3-methoxyphenyl]-N-ethylprop-2-enamide |
| SMILES | CCN(CC(=O)Nc1c(Cl)cccc1Cl)C(=O)/C=C/c1ccc(OC(F)F)c(OC)c1 |
| InChI | InChI=1S/C21H20Cl2F2N2O4/c1-3-27(12-18(28)26-20-14(22)5-4-6-15(20)23)19(29)10-8-13-7-9-16(31-21(24)25)17(11-13)30-2/h4-11,21H,3,12H2,1-2H3,(H,26,28)/b10-8+ |
| InChIKey | RFUFYLYGXRUGGR-CSKARUKUSA-N |
| XLogP | 5.10 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.30 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|