C20H19ClF2N2O4 — CID 6218106
(E)-N-[2-(4-chloroanilino)-2-oxoethyl]-3-[4-(difluoromethoxy)-3-methoxyphenyl]-N-methylprop-2-enamide (PubChem CID 6218106) has the molecular formula C20H19ClF2N2O4 and a molecular weight of 424.83 g/mol. Its IUPAC name is (E)-N-[2-(4-chloroanilino)-2-oxoethyl]-3-[4-(difluoromethoxy)-3-methoxyphenyl]-N-methylprop-2-enamide.
| Compound Name | (E)-N-[2-(4-chloroanilino)-2-oxoethyl]-3-[4-(difluoromethoxy)-3-methoxyphenyl]-N-methylprop-2-enamide |
|---|---|
| PubChem CID | 6218106 |
| Molecular Formula | C20H19ClF2N2O4 |
| Molecular Weight | 424.83 g/mol |
| Exact Mass | 424.10 |
| IUPAC Name | (E)-N-[2-(4-chloroanilino)-2-oxoethyl]-3-[4-(difluoromethoxy)-3-methoxyphenyl]-N-methylprop-2-enamide |
| SMILES | COc1cc(/C=C/C(=O)N(C)CC(=O)Nc2ccc(Cl)cc2)ccc1OC(F)F |
| InChI | InChI=1S/C20H19ClF2N2O4/c1-25(12-18(26)24-15-7-5-14(21)6-8-15)19(27)10-4-13-3-9-16(29-20(22)23)17(11-13)28-2/h3-11,20H,12H2,1-2H3,(H,24,26)/b10-4+ |
| InChIKey | MDCIIZMYGDJTSJ-ONNFQVAWSA-N |
| XLogP | 4.06 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.83 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|