C20H18Cl2F2N2O4 — CID 30254107
(E)-N-[2-(3,4-dichloroanilino)-2-oxoethyl]-3-[4-(difluoromethoxy)-3-methoxyphenyl]-N-methylprop-2-enamide (PubChem CID 30254107) has the molecular formula C20H18Cl2F2N2O4 and a molecular weight of 459.28 g/mol. Its IUPAC name is (E)-N-[2-(3,4-dichloroanilino)-2-oxoethyl]-3-[4-(difluoromethoxy)-3-methoxyphenyl]-N-methylprop-2-enamide.
| Compound Name | (E)-N-[2-(3,4-dichloroanilino)-2-oxoethyl]-3-[4-(difluoromethoxy)-3-methoxyphenyl]-N-methylprop-2-enamide |
|---|---|
| PubChem CID | 30254107 |
| Molecular Formula | C20H18Cl2F2N2O4 |
| Molecular Weight | 459.28 g/mol |
| Exact Mass | 458.06 |
| IUPAC Name | (E)-N-[2-(3,4-dichloroanilino)-2-oxoethyl]-3-[4-(difluoromethoxy)-3-methoxyphenyl]-N-methylprop-2-enamide |
| SMILES | COc1cc(/C=C/C(=O)N(C)CC(=O)Nc2ccc(Cl)c(Cl)c2)ccc1OC(F)F |
| InChI | InChI=1S/C20H18Cl2F2N2O4/c1-26(11-18(27)25-13-5-6-14(21)15(22)10-13)19(28)8-4-12-3-7-16(30-20(23)24)17(9-12)29-2/h3-10,20H,11H2,1-2H3,(H,25,27)/b8-4+ |
| InChIKey | CLZCDLJYEDBGFI-XBXARRHUSA-N |
| XLogP | 4.71 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.28 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|