C20H15ClF2N2O5 — CID 42968369
[2-(3-chloro-4-cyanoanilino)-2-oxoethyl] (E)-3-[4-(difluoromethoxy)-3-methoxyphenyl]prop-2-enoate (PubChem CID 42968369) has the molecular formula C20H15ClF2N2O5 and a molecular weight of 436.80 g/mol. Its IUPAC name is [2-(3-chloro-4-cyanoanilino)-2-oxoethyl] (E)-3-[4-(difluoromethoxy)-3-methoxyphenyl]prop-2-enoate.
| Compound Name | [2-(3-chloro-4-cyanoanilino)-2-oxoethyl] (E)-3-[4-(difluoromethoxy)-3-methoxyphenyl]prop-2-enoate |
|---|---|
| PubChem CID | 42968369 |
| Molecular Formula | C20H15ClF2N2O5 |
| Molecular Weight | 436.80 g/mol |
| Exact Mass | 436.06 |
| IUPAC Name | [2-(3-chloro-4-cyanoanilino)-2-oxoethyl] (E)-3-[4-(difluoromethoxy)-3-methoxyphenyl]prop-2-enoate |
| SMILES | COc1cc(/C=C/C(=O)OCC(=O)Nc2ccc(C#N)c(Cl)c2)ccc1OC(F)F |
| InChI | InChI=1S/C20H15ClF2N2O5/c1-28-17-8-12(2-6-16(17)30-20(22)23)3-7-19(27)29-11-18(26)25-14-5-4-13(10-24)15(21)9-14/h2-9,20H,11H2,1H3,(H,25,26)/b7-3+ |
| InChIKey | CKKWQIGVBGRTEO-XVNBXDOJSA-N |
| XLogP | 4.02 |
| TPSA | 97.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.80 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|