C21H24N2O5 — CID 9418815
(E)-3-(3,4-dimethoxyphenyl)-N-[2-(3-methoxyanilino)-2-oxoethyl]-N-methylprop-2-enamide (PubChem CID 9418815) has the molecular formula C21H24N2O5 and a molecular weight of 384.43 g/mol. Its IUPAC name is (E)-3-(3,4-dimethoxyphenyl)-N-[2-(3-methoxyanilino)-2-oxoethyl]-N-methylprop-2-enamide.
| Compound Name | (E)-3-(3,4-dimethoxyphenyl)-N-[2-(3-methoxyanilino)-2-oxoethyl]-N-methylprop-2-enamide |
|---|---|
| PubChem CID | 9418815 |
| Molecular Formula | C21H24N2O5 |
| Molecular Weight | 384.43 g/mol |
| Exact Mass | 384.17 |
| IUPAC Name | (E)-3-(3,4-dimethoxyphenyl)-N-[2-(3-methoxyanilino)-2-oxoethyl]-N-methylprop-2-enamide |
| SMILES | COc1cccc(NC(=O)CN(C)C(=O)/C=C/c2ccc(OC)c(OC)c2)c1 |
| InChI | InChI=1S/C21H24N2O5/c1-23(14-20(24)22-16-6-5-7-17(13-16)26-2)21(25)11-9-15-8-10-18(27-3)19(12-15)28-4/h5-13H,14H2,1-4H3,(H,22,24)/b11-9+ |
| InChIKey | KJZXGJCYTMQMLQ-PKNBQFBNSA-N |
| XLogP | 2.82 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.43 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|