C26H32N2O7 — CID 34775687
[2-[[2-(3-methoxyanilino)-2-oxoethyl]-methylamino]-2-oxoethyl] (E)-3-(3-ethoxy-4-propoxyphenyl)prop-2-enoate (PubChem CID 34775687) has the molecular formula C26H32N2O7 and a molecular weight of 484.55 g/mol. Its IUPAC name is [2-[[2-(3-methoxyanilino)-2-oxoethyl]-methylamino]-2-oxoethyl] (E)-3-(3-ethoxy-4-propoxyphenyl)prop-2-enoate.
| Compound Name | [2-[[2-(3-methoxyanilino)-2-oxoethyl]-methylamino]-2-oxoethyl] (E)-3-(3-ethoxy-4-propoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 34775687 |
| Molecular Formula | C26H32N2O7 |
| Molecular Weight | 484.55 g/mol |
| Exact Mass | 484.22 |
| IUPAC Name | [2-[[2-(3-methoxyanilino)-2-oxoethyl]-methylamino]-2-oxoethyl] (E)-3-(3-ethoxy-4-propoxyphenyl)prop-2-enoate |
| SMILES | CCCOc1ccc(/C=C/C(=O)OCC(=O)N(C)CC(=O)Nc2cccc(OC)c2)cc1OCC |
| InChI | InChI=1S/C26H32N2O7/c1-5-14-34-22-12-10-19(15-23(22)33-6-2)11-13-26(31)35-18-25(30)28(3)17-24(29)27-20-8-7-9-21(16-20)32-4/h7-13,15-16H,5-6,14,17-18H2,1-4H3,(H,27,29)/b13-11+ |
| InChIKey | YMCABICLXFIUFR-ACCUITESSA-N |
| XLogP | 3.54 |
| TPSA | 103.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.55 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|