C27H35NO7 — CID 30442109
[2-[(3,4-dimethoxyphenyl)methyl-methylamino]-2-oxoethyl] (E)-3-(4-butoxy-3-ethoxyphenyl)prop-2-enoate (PubChem CID 30442109) has the molecular formula C27H35NO7 and a molecular weight of 485.58 g/mol. Its IUPAC name is [2-[(3,4-dimethoxyphenyl)methyl-methylamino]-2-oxoethyl] (E)-3-(4-butoxy-3-ethoxyphenyl)prop-2-enoate.
| Compound Name | [2-[(3,4-dimethoxyphenyl)methyl-methylamino]-2-oxoethyl] (E)-3-(4-butoxy-3-ethoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 30442109 |
| Molecular Formula | C27H35NO7 |
| Molecular Weight | 485.58 g/mol |
| Exact Mass | 485.24 |
| IUPAC Name | [2-[(3,4-dimethoxyphenyl)methyl-methylamino]-2-oxoethyl] (E)-3-(4-butoxy-3-ethoxyphenyl)prop-2-enoate |
| SMILES | CCCCOc1ccc(/C=C/C(=O)OCC(=O)N(C)Cc2ccc(OC)c(OC)c2)cc1OCC |
| InChI | InChI=1S/C27H35NO7/c1-6-8-15-34-23-13-9-20(16-25(23)33-7-2)11-14-27(30)35-19-26(29)28(3)18-21-10-12-22(31-4)24(17-21)32-5/h9-14,16-17H,6-8,15,18-19H2,1-5H3/b14-11+ |
| InChIKey | JFWLAJHNOLKDRS-SDNWHVSQSA-N |
| XLogP | 4.50 |
| TPSA | 83.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.58 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|