C24H28Cl2N2O4 — CID 46647935
(E)-N-[2-(2,6-dichloroanilino)-2-oxoethyl]-N-ethyl-3-[3-methoxy-4-(2-methylpropoxy)phenyl]prop-2-enamide (PubChem CID 46647935) has the molecular formula C24H28Cl2N2O4 and a molecular weight of 479.40 g/mol. Its IUPAC name is (E)-N-[2-(2,6-dichloroanilino)-2-oxoethyl]-N-ethyl-3-[3-methoxy-4-(2-methylpropoxy)phenyl]prop-2-enamide.
| Compound Name | (E)-N-[2-(2,6-dichloroanilino)-2-oxoethyl]-N-ethyl-3-[3-methoxy-4-(2-methylpropoxy)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 46647935 |
| Molecular Formula | C24H28Cl2N2O4 |
| Molecular Weight | 479.40 g/mol |
| Exact Mass | 478.14 |
| IUPAC Name | (E)-N-[2-(2,6-dichloroanilino)-2-oxoethyl]-N-ethyl-3-[3-methoxy-4-(2-methylpropoxy)phenyl]prop-2-enamide |
| SMILES | CCN(CC(=O)Nc1c(Cl)cccc1Cl)C(=O)/C=C/c1ccc(OCC(C)C)c(OC)c1 |
| InChI | InChI=1S/C24H28Cl2N2O4/c1-5-28(14-22(29)27-24-18(25)7-6-8-19(24)26)23(30)12-10-17-9-11-20(21(13-17)31-4)32-15-16(2)3/h6-13,16H,5,14-15H2,1-4H3,(H,27,29)/b12-10+ |
| InChIKey | JVHXGSIBRZQFPL-ZRDIBKRKSA-N |
| XLogP | 5.54 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.40 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|