C27H30N2O5 — CID 24518009
(E)-N-(2-anilino-2-oxoethyl)-N-(furan-2-ylmethyl)-3-[3-methoxy-4-(2-methylpropoxy)phenyl]prop-2-enamide (PubChem CID 24518009) has the molecular formula C27H30N2O5 and a molecular weight of 462.55 g/mol. Its IUPAC name is (E)-N-(2-anilino-2-oxoethyl)-N-(furan-2-ylmethyl)-3-[3-methoxy-4-(2-methylpropoxy)phenyl]prop-2-enamide.
| Compound Name | (E)-N-(2-anilino-2-oxoethyl)-N-(furan-2-ylmethyl)-3-[3-methoxy-4-(2-methylpropoxy)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 24518009 |
| Molecular Formula | C27H30N2O5 |
| Molecular Weight | 462.55 g/mol |
| Exact Mass | 462.22 |
| IUPAC Name | (E)-N-(2-anilino-2-oxoethyl)-N-(furan-2-ylmethyl)-3-[3-methoxy-4-(2-methylpropoxy)phenyl]prop-2-enamide |
| SMILES | COc1cc(/C=C/C(=O)N(CC(=O)Nc2ccccc2)Cc2ccco2)ccc1OCC(C)C |
| InChI | InChI=1S/C27H30N2O5/c1-20(2)19-34-24-13-11-21(16-25(24)32-3)12-14-27(31)29(17-23-10-7-15-33-23)18-26(30)28-22-8-5-4-6-9-22/h4-16,20H,17-19H2,1-3H3,(H,28,30)/b14-12+ |
| InChIKey | OKBSEBJHZRAXBT-WYMLVPIESA-N |
| XLogP | 5.00 |
| TPSA | 81.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.55 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|