C24H29ClF3N2O2+ — CID 157443539
4-chloro-3,5-dimethyloxane;[4-[3-[3-(trifluoromethyl)phenyl]prop-2-enoylamino]phenyl]methylazanium (PubChem CID 157443539) has the molecular formula C24H29ClF3N2O2+ and a molecular weight of 469.96 g/mol. Its IUPAC name is 4-chloro-3,5-dimethyloxane;[4-[3-[3-(trifluoromethyl)phenyl]prop-2-enoylamino]phenyl]methylazanium.
| Compound Name | 4-chloro-3,5-dimethyloxane;[4-[3-[3-(trifluoromethyl)phenyl]prop-2-enoylamino]phenyl]methylazanium |
|---|---|
| PubChem CID | 157443539 |
| Molecular Formula | C24H29ClF3N2O2+ |
| Molecular Weight | 469.96 g/mol |
| Exact Mass | 469.19 |
| IUPAC Name | 4-chloro-3,5-dimethyloxane;[4-[3-[3-(trifluoromethyl)phenyl]prop-2-enoylamino]phenyl]methylazanium |
| SMILES | CC1COCC(C)C1Cl.[NH3+]Cc1ccc(NC(=O)C=Cc2cccc(C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C17H15F3N2O.C7H13ClO/c18-17(19,20)14-3-1-2-12(10-14)6-9-16(23)22-15-7-4-13(11-21)5-8-15;1-5-3-9-4-6(2)7(5)8/h1-10H,11,21H2,(H,22,23);5-7H,3-4H2,1-2H3/p+1 |
| InChIKey | BRYNJQAAUXBJPG-UHFFFAOYSA-O |
| XLogP | 5.00 |
| TPSA | 65.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.96 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|