C20H15F3N4O2 — CID 24645614
3-phenyl-N'-[(E)-3-[3-(trifluoromethyl)phenyl]prop-2-enoyl]-1H-pyrazole-5-carbohydrazide (PubChem CID 24645614) has the molecular formula C20H15F3N4O2 and a molecular weight of 400.36 g/mol. Its IUPAC name is 3-phenyl-N'-[(E)-3-[3-(trifluoromethyl)phenyl]prop-2-enoyl]-1H-pyrazole-5-carbohydrazide.
| Compound Name | 3-phenyl-N'-[(E)-3-[3-(trifluoromethyl)phenyl]prop-2-enoyl]-1H-pyrazole-5-carbohydrazide |
|---|---|
| PubChem CID | 24645614 |
| Molecular Formula | C20H15F3N4O2 |
| Molecular Weight | 400.36 g/mol |
| Exact Mass | 400.11 |
| IUPAC Name | 3-phenyl-N'-[(E)-3-[3-(trifluoromethyl)phenyl]prop-2-enoyl]-1H-pyrazole-5-carbohydrazide |
| SMILES | O=C(/C=C/c1cccc(C(F)(F)F)c1)NNC(=O)c1cc(-c2ccccc2)n[nH]1 |
| InChI | InChI=1S/C20H15F3N4O2/c21-20(22,23)15-8-4-5-13(11-15)9-10-18(28)26-27-19(29)17-12-16(24-25-17)14-6-2-1-3-7-14/h1-12H,(H,24,25)(H,26,28)(H,27,29)/b10-9+ |
| InChIKey | DFPCMFOSPUNRJD-MDZDMXLPSA-N |
| XLogP | 3.57 |
| TPSA | 86.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.36 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|