C19H15F3N4O2 — CID 7907311
3-phenyl-N'-[2-[3-(trifluoromethyl)phenyl]acetyl]-1H-pyrazole-5-carbohydrazide (PubChem CID 7907311) has the molecular formula C19H15F3N4O2 and a molecular weight of 388.35 g/mol. Its IUPAC name is 3-phenyl-N'-[2-[3-(trifluoromethyl)phenyl]acetyl]-1H-pyrazole-5-carbohydrazide.
| Compound Name | 3-phenyl-N'-[2-[3-(trifluoromethyl)phenyl]acetyl]-1H-pyrazole-5-carbohydrazide |
|---|---|
| PubChem CID | 7907311 |
| Molecular Formula | C19H15F3N4O2 |
| Molecular Weight | 388.35 g/mol |
| Exact Mass | 388.11 |
| IUPAC Name | 3-phenyl-N'-[2-[3-(trifluoromethyl)phenyl]acetyl]-1H-pyrazole-5-carbohydrazide |
| SMILES | O=C(Cc1cccc(C(F)(F)F)c1)NNC(=O)c1cc(-c2ccccc2)n[nH]1 |
| InChI | InChI=1S/C19H15F3N4O2/c20-19(21,22)14-8-4-5-12(9-14)10-17(27)25-26-18(28)16-11-15(23-24-16)13-6-2-1-3-7-13/h1-9,11H,10H2,(H,23,24)(H,25,27)(H,26,28) |
| InChIKey | QTTJMKARDKOALX-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 86.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.35 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|