C23H19Cl2N3O5S — CID 5442791
N-[(Z)-1,3-benzodioxol-5-ylmethylideneamino]-4-[(2,3-dichloro-N-methylsulfonylanilino)methyl]benzamide (PubChem CID 5442791) has the molecular formula C23H19Cl2N3O5S and a molecular weight of 520.39 g/mol. Its IUPAC name is N-[(Z)-1,3-benzodioxol-5-ylmethylideneamino]-4-[(2,3-dichloro-N-methylsulfonylanilino)methyl]benzamide.
| Compound Name | N-[(Z)-1,3-benzodioxol-5-ylmethylideneamino]-4-[(2,3-dichloro-N-methylsulfonylanilino)methyl]benzamide |
|---|---|
| PubChem CID | 5442791 |
| Molecular Formula | C23H19Cl2N3O5S |
| Molecular Weight | 520.39 g/mol |
| Exact Mass | 519.04 |
| IUPAC Name | N-[(Z)-1,3-benzodioxol-5-ylmethylideneamino]-4-[(2,3-dichloro-N-methylsulfonylanilino)methyl]benzamide |
| SMILES | CS(=O)(=O)N(Cc1ccc(C(=O)N/N=C\c2ccc3c(c2)OCO3)cc1)c1cccc(Cl)c1Cl |
| InChI | InChI=1S/C23H19Cl2N3O5S/c1-34(30,31)28(19-4-2-3-18(24)22(19)25)13-15-5-8-17(9-6-15)23(29)27-26-12-16-7-10-20-21(11-16)33-14-32-20/h2-12H,13-14H2,1H3,(H,27,29)/b26-12- |
| InChIKey | IMNUYUPYOVPNNO-ZRGSRPPYSA-N |
| XLogP | 4.45 |
| TPSA | 97.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.39 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|