C28H34N4O5S — CID 136504663
N-[[4-(diethylamino)-2-hydroxyphenyl]methylideneamino]-2-(N-(4-ethoxyphenyl)sulfonyl-4-methylanilino)acetamide (PubChem CID 136504663) has the molecular formula C28H34N4O5S and a molecular weight of 538.67 g/mol. Its IUPAC name is N-[[4-(diethylamino)-2-hydroxyphenyl]methylideneamino]-2-(N-(4-ethoxyphenyl)sulfonyl-4-methylanilino)acetamide.
| Compound Name | N-[[4-(diethylamino)-2-hydroxyphenyl]methylideneamino]-2-(N-(4-ethoxyphenyl)sulfonyl-4-methylanilino)acetamide |
|---|---|
| PubChem CID | 136504663 |
| Molecular Formula | C28H34N4O5S |
| Molecular Weight | 538.67 g/mol |
| Exact Mass | 538.22 |
| IUPAC Name | N-[[4-(diethylamino)-2-hydroxyphenyl]methylideneamino]-2-(N-(4-ethoxyphenyl)sulfonyl-4-methylanilino)acetamide |
| SMILES | CCOc1ccc(S(=O)(=O)N(CC(=O)NN=Cc2ccc(N(CC)CC)cc2O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C28H34N4O5S/c1-5-31(6-2)24-13-10-22(27(33)18-24)19-29-30-28(34)20-32(23-11-8-21(4)9-12-23)38(35,36)26-16-14-25(15-17-26)37-7-3/h8-19,33H,5-7,20H2,1-4H3,(H,30,34) |
| InChIKey | MPJYFSTUXZYWKA-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 111.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.67 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|