C18H19BrN4O5S — CID 126189881
N-[(Z)-[4-(2-amino-2-oxoethoxy)phenyl]methylideneamino]-2-(2-bromo-N-methylsulfonylanilino)acetamide (PubChem CID 126189881) has the molecular formula C18H19BrN4O5S and a molecular weight of 483.34 g/mol. Its IUPAC name is N-[(Z)-[4-(2-amino-2-oxoethoxy)phenyl]methylideneamino]-2-(2-bromo-N-methylsulfonylanilino)acetamide.
| Compound Name | N-[(Z)-[4-(2-amino-2-oxoethoxy)phenyl]methylideneamino]-2-(2-bromo-N-methylsulfonylanilino)acetamide |
|---|---|
| PubChem CID | 126189881 |
| Molecular Formula | C18H19BrN4O5S |
| Molecular Weight | 483.34 g/mol |
| Exact Mass | 482.03 |
| IUPAC Name | N-[(Z)-[4-(2-amino-2-oxoethoxy)phenyl]methylideneamino]-2-(2-bromo-N-methylsulfonylanilino)acetamide |
| SMILES | CS(=O)(=O)N(CC(=O)N/N=C\c1ccc(OCC(N)=O)cc1)c1ccccc1Br |
| InChI | InChI=1S/C18H19BrN4O5S/c1-29(26,27)23(16-5-3-2-4-15(16)19)11-18(25)22-21-10-13-6-8-14(9-7-13)28-12-17(20)24/h2-10H,11-12H2,1H3,(H2,20,24)(H,22,25)/b21-10- |
| InChIKey | DXWFXTXZDXRAJW-FBHDLOMBSA-N |
| XLogP | 1.23 |
| TPSA | 131.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.34 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|