C30H30N4O5S — CID 126189652
2-[methylsulfonyl(naphthalen-1-yl)amino]-N-[(Z)-[4-[2-oxo-2-[[(1S)-1-phenylethyl]amino]ethoxy]phenyl]methylideneamino]acetamide (PubChem CID 126189652) has the molecular formula C30H30N4O5S and a molecular weight of 558.66 g/mol. Its IUPAC name is 2-[methylsulfonyl(naphthalen-1-yl)amino]-N-[(Z)-[4-[2-oxo-2-[[(1S)-1-phenylethyl]amino]ethoxy]phenyl]methylideneamino]acetamide.
| Compound Name | 2-[methylsulfonyl(naphthalen-1-yl)amino]-N-[(Z)-[4-[2-oxo-2-[[(1S)-1-phenylethyl]amino]ethoxy]phenyl]methylideneamino]acetamide |
|---|---|
| PubChem CID | 126189652 |
| Molecular Formula | C30H30N4O5S |
| Molecular Weight | 558.66 g/mol |
| Exact Mass | 558.19 |
| IUPAC Name | 2-[methylsulfonyl(naphthalen-1-yl)amino]-N-[(Z)-[4-[2-oxo-2-[[(1S)-1-phenylethyl]amino]ethoxy]phenyl]methylideneamino]acetamide |
| SMILES | C[C@H](NC(=O)COc1ccc(/C=N\NC(=O)CN(c2cccc3ccccc23)S(C)(=O)=O)cc1)c1ccccc1 |
| InChI | InChI=1S/C30H30N4O5S/c1-22(24-9-4-3-5-10-24)32-30(36)21-39-26-17-15-23(16-18-26)19-31-33-29(35)20-34(40(2,37)38)28-14-8-12-25-11-6-7-13-27(25)28/h3-19,22H,20-21H2,1-2H3,(H,32,36)(H,33,35)/b31-19-/t22-/m0/s1 |
| InChIKey | BQZCAKODNJGORR-VYUDFNMKSA-N |
| XLogP | 4.01 |
| TPSA | 117.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.66 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|