C33H32ClN5O8S — CID 126129898
2-(5-chloro-2-methoxy-N-(4-methyl-3-nitrophenyl)sulfonylanilino)-N-[(Z)-[4-[2-oxo-2-[[(1R)-1-phenylethyl]amino]ethoxy]phenyl]methylideneamino]acetamide (PubChem CID 126129898) has the molecular formula C33H32ClN5O8S and a molecular weight of 694.17 g/mol. Its IUPAC name is 2-(5-chloro-2-methoxy-N-(4-methyl-3-nitrophenyl)sulfonylanilino)-N-[(Z)-[4-[2-oxo-2-[[(1R)-1-phenylethyl]amino]ethoxy]phenyl]methylideneamino]acetamide.
| Compound Name | 2-(5-chloro-2-methoxy-N-(4-methyl-3-nitrophenyl)sulfonylanilino)-N-[(Z)-[4-[2-oxo-2-[[(1R)-1-phenylethyl]amino]ethoxy]phenyl]methylideneamino]acetamide |
|---|---|
| PubChem CID | 126129898 |
| Molecular Formula | C33H32ClN5O8S |
| Molecular Weight | 694.17 g/mol |
| Exact Mass | 693.17 |
| IUPAC Name | 2-(5-chloro-2-methoxy-N-(4-methyl-3-nitrophenyl)sulfonylanilino)-N-[(Z)-[4-[2-oxo-2-[[(1R)-1-phenylethyl]amino]ethoxy]phenyl]methylideneamino]acetamide |
| SMILES | COc1ccc(Cl)cc1N(CC(=O)N/N=C\c1ccc(OCC(=O)N[C@H](C)c2ccccc2)cc1)S(=O)(=O)c1ccc(C)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C33H32ClN5O8S/c1-22-9-15-28(18-29(22)39(42)43)48(44,45)38(30-17-26(34)12-16-31(30)46-3)20-32(40)37-35-19-24-10-13-27(14-11-24)47-21-33(41)36-23(2)25-7-5-4-6-8-25/h4-19,23H,20-21H2,1-3H3,(H,36,41)(H,37,40)/b35-19-/t23-/m1/s1 |
| InChIKey | DAMQIFUNYAUVAP-IHIPLHRRSA-N |
| XLogP | 5.17 |
| TPSA | 169.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 694.17 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|