C32H31ClN4O5S — CID 129440945
4-[(2-chlorophenyl)methyl-methylsulfonylamino]-N-[[4-[2-oxo-2-[[(1R)-1-phenylethyl]amino]ethoxy]phenyl]methylideneamino]benzamide (PubChem CID 129440945) has the molecular formula C32H31ClN4O5S and a molecular weight of 619.14 g/mol. Its IUPAC name is 4-[(2-chlorophenyl)methyl-methylsulfonylamino]-N-[[4-[2-oxo-2-[[(1R)-1-phenylethyl]amino]ethoxy]phenyl]methylideneamino]benzamide.
| Compound Name | 4-[(2-chlorophenyl)methyl-methylsulfonylamino]-N-[[4-[2-oxo-2-[[(1R)-1-phenylethyl]amino]ethoxy]phenyl]methylideneamino]benzamide |
|---|---|
| PubChem CID | 129440945 |
| Molecular Formula | C32H31ClN4O5S |
| Molecular Weight | 619.14 g/mol |
| Exact Mass | 618.17 |
| IUPAC Name | 4-[(2-chlorophenyl)methyl-methylsulfonylamino]-N-[[4-[2-oxo-2-[[(1R)-1-phenylethyl]amino]ethoxy]phenyl]methylideneamino]benzamide |
| SMILES | C[C@@H](NC(=O)COc1ccc(C=NNC(=O)c2ccc(N(Cc3ccccc3Cl)S(C)(=O)=O)cc2)cc1)c1ccccc1 |
| InChI | InChI=1S/C32H31ClN4O5S/c1-23(25-8-4-3-5-9-25)35-31(38)22-42-29-18-12-24(13-19-29)20-34-36-32(39)26-14-16-28(17-15-26)37(43(2,40)41)21-27-10-6-7-11-30(27)33/h3-20,23H,21-22H2,1-2H3,(H,35,38)(H,36,39)/t23-/m1/s1 |
| InChIKey | WOPLKVKDJOTTRI-HSZRJFAPSA-N |
| XLogP | 5.33 |
| TPSA | 117.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.14 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|