C21H26N4O5S — CID 126117645
4-[methyl(methylsulfonyl)amino]-N-[(Z)-[4-[2-oxo-2-(propan-2-ylamino)ethoxy]phenyl]methylideneamino]benzamide (PubChem CID 126117645) has the molecular formula C21H26N4O5S and a molecular weight of 446.53 g/mol. Its IUPAC name is 4-[methyl(methylsulfonyl)amino]-N-[(Z)-[4-[2-oxo-2-(propan-2-ylamino)ethoxy]phenyl]methylideneamino]benzamide.
| Compound Name | 4-[methyl(methylsulfonyl)amino]-N-[(Z)-[4-[2-oxo-2-(propan-2-ylamino)ethoxy]phenyl]methylideneamino]benzamide |
|---|---|
| PubChem CID | 126117645 |
| Molecular Formula | C21H26N4O5S |
| Molecular Weight | 446.53 g/mol |
| Exact Mass | 446.16 |
| IUPAC Name | 4-[methyl(methylsulfonyl)amino]-N-[(Z)-[4-[2-oxo-2-(propan-2-ylamino)ethoxy]phenyl]methylideneamino]benzamide |
| SMILES | CC(C)NC(=O)COc1ccc(/C=N\NC(=O)c2ccc(N(C)S(C)(=O)=O)cc2)cc1 |
| InChI | InChI=1S/C21H26N4O5S/c1-15(2)23-20(26)14-30-19-11-5-16(6-12-19)13-22-24-21(27)17-7-9-18(10-8-17)25(3)31(4,28)29/h5-13,15H,14H2,1-4H3,(H,23,26)(H,24,27)/b22-13- |
| InChIKey | HYNWCFCOTYFDFI-XKZIYDEJSA-N |
| XLogP | 1.75 |
| TPSA | 117.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.53 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|