C22H29N3O6S — CID 2857028
N-[(3,4-diethoxyphenyl)methylideneamino]-2-(4-methoxy-N-methylsulfonylanilino)propanamide (PubChem CID 2857028) has the molecular formula C22H29N3O6S and a molecular weight of 463.56 g/mol. Its IUPAC name is N-[(3,4-diethoxyphenyl)methylideneamino]-2-(4-methoxy-N-methylsulfonylanilino)propanamide.
| Compound Name | N-[(3,4-diethoxyphenyl)methylideneamino]-2-(4-methoxy-N-methylsulfonylanilino)propanamide |
|---|---|
| PubChem CID | 2857028 |
| Molecular Formula | C22H29N3O6S |
| Molecular Weight | 463.56 g/mol |
| Exact Mass | 463.18 |
| IUPAC Name | N-[(3,4-diethoxyphenyl)methylideneamino]-2-(4-methoxy-N-methylsulfonylanilino)propanamide |
| SMILES | CCOc1ccc(C=NNC(=O)C(C)N(c2ccc(OC)cc2)S(C)(=O)=O)cc1OCC |
| InChI | InChI=1S/C22H29N3O6S/c1-6-30-20-13-8-17(14-21(20)31-7-2)15-23-24-22(26)16(3)25(32(5,27)28)18-9-11-19(29-4)12-10-18/h8-16H,6-7H2,1-5H3,(H,24,26) |
| InChIKey | RPDQHWBOZSMORE-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 106.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.56 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|