C21H25N3O5S2 — CID 129439679
(2S)-2-(4-methoxy-N-methylsulfonylanilino)-N-[[4-(thietan-3-yloxy)phenyl]methylideneamino]propanamide (PubChem CID 129439679) has the molecular formula C21H25N3O5S2 and a molecular weight of 463.58 g/mol. Its IUPAC name is (2S)-2-(4-methoxy-N-methylsulfonylanilino)-N-[[4-(thietan-3-yloxy)phenyl]methylideneamino]propanamide.
| Compound Name | (2S)-2-(4-methoxy-N-methylsulfonylanilino)-N-[[4-(thietan-3-yloxy)phenyl]methylideneamino]propanamide |
|---|---|
| PubChem CID | 129439679 |
| Molecular Formula | C21H25N3O5S2 |
| Molecular Weight | 463.58 g/mol |
| Exact Mass | 463.12 |
| IUPAC Name | (2S)-2-(4-methoxy-N-methylsulfonylanilino)-N-[[4-(thietan-3-yloxy)phenyl]methylideneamino]propanamide |
| SMILES | COc1ccc(N([C@@H](C)C(=O)NN=Cc2ccc(OC3CSC3)cc2)S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C21H25N3O5S2/c1-15(24(31(3,26)27)17-6-10-18(28-2)11-7-17)21(25)23-22-12-16-4-8-19(9-5-16)29-20-13-30-14-20/h4-12,15,20H,13-14H2,1-3H3,(H,23,25)/t15-/m0/s1 |
| InChIKey | NUXRWXJRAFXJDC-HNNXBMFYSA-N |
| XLogP | 2.49 |
| TPSA | 97.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.58 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|