C29H29N3O5S — CID 98123921
(2R)-2-(4-methoxy-N-methylsulfonylanilino)-N-[(Z)-[4-(naphthalen-1-ylmethoxy)phenyl]methylideneamino]propanamide (PubChem CID 98123921) has the molecular formula C29H29N3O5S and a molecular weight of 531.63 g/mol. Its IUPAC name is (2R)-2-(4-methoxy-N-methylsulfonylanilino)-N-[(Z)-[4-(naphthalen-1-ylmethoxy)phenyl]methylideneamino]propanamide.
| Compound Name | (2R)-2-(4-methoxy-N-methylsulfonylanilino)-N-[(Z)-[4-(naphthalen-1-ylmethoxy)phenyl]methylideneamino]propanamide |
|---|---|
| PubChem CID | 98123921 |
| Molecular Formula | C29H29N3O5S |
| Molecular Weight | 531.63 g/mol |
| Exact Mass | 531.18 |
| IUPAC Name | (2R)-2-(4-methoxy-N-methylsulfonylanilino)-N-[(Z)-[4-(naphthalen-1-ylmethoxy)phenyl]methylideneamino]propanamide |
| SMILES | COc1ccc(N([C@H](C)C(=O)N/N=C\c2ccc(OCc3cccc4ccccc34)cc2)S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C29H29N3O5S/c1-21(32(38(3,34)35)25-13-17-26(36-2)18-14-25)29(33)31-30-19-22-11-15-27(16-12-22)37-20-24-9-6-8-23-7-4-5-10-28(23)24/h4-19,21H,20H2,1-3H3,(H,31,33)/b30-19-/t21-/m1/s1 |
| InChIKey | HEQFCVFUSOLDBQ-QYJXRTEHSA-N |
| XLogP | 4.73 |
| TPSA | 97.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.63 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|