C34H31N3O4S — CID 126140667
4-[(2-methylphenyl)methyl-methylsulfonylamino]-N-[(Z)-[4-(naphthalen-1-ylmethoxy)phenyl]methylideneamino]benzamide (PubChem CID 126140667) has the molecular formula C34H31N3O4S and a molecular weight of 577.71 g/mol. Its IUPAC name is 4-[(2-methylphenyl)methyl-methylsulfonylamino]-N-[(Z)-[4-(naphthalen-1-ylmethoxy)phenyl]methylideneamino]benzamide.
| Compound Name | 4-[(2-methylphenyl)methyl-methylsulfonylamino]-N-[(Z)-[4-(naphthalen-1-ylmethoxy)phenyl]methylideneamino]benzamide |
|---|---|
| PubChem CID | 126140667 |
| Molecular Formula | C34H31N3O4S |
| Molecular Weight | 577.71 g/mol |
| Exact Mass | 577.20 |
| IUPAC Name | 4-[(2-methylphenyl)methyl-methylsulfonylamino]-N-[(Z)-[4-(naphthalen-1-ylmethoxy)phenyl]methylideneamino]benzamide |
| SMILES | Cc1ccccc1CN(c1ccc(C(=O)N/N=C\c2ccc(OCc3cccc4ccccc34)cc2)cc1)S(C)(=O)=O |
| InChI | InChI=1S/C34H31N3O4S/c1-25-8-3-4-10-29(25)23-37(42(2,39)40)31-18-16-28(17-19-31)34(38)36-35-22-26-14-20-32(21-15-26)41-24-30-12-7-11-27-9-5-6-13-33(27)30/h3-22H,23-24H2,1-2H3,(H,36,38)/b35-22- |
| InChIKey | OJRZTJFIDDNTLG-QHDYCIAZSA-N |
| XLogP | 6.46 |
| TPSA | 88.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.71 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|