C26H22N2O3 — CID 126153771
(2S)-2-hydroxy-N-[(Z)-[4-(naphthalen-1-ylmethoxy)phenyl]methylideneamino]-2-phenylacetamide (PubChem CID 126153771) has the molecular formula C26H22N2O3 and a molecular weight of 410.47 g/mol. Its IUPAC name is (2S)-2-hydroxy-N-[(Z)-[4-(naphthalen-1-ylmethoxy)phenyl]methylideneamino]-2-phenylacetamide.
| Compound Name | (2S)-2-hydroxy-N-[(Z)-[4-(naphthalen-1-ylmethoxy)phenyl]methylideneamino]-2-phenylacetamide |
|---|---|
| PubChem CID | 126153771 |
| Molecular Formula | C26H22N2O3 |
| Molecular Weight | 410.47 g/mol |
| Exact Mass | 410.16 |
| IUPAC Name | (2S)-2-hydroxy-N-[(Z)-[4-(naphthalen-1-ylmethoxy)phenyl]methylideneamino]-2-phenylacetamide |
| SMILES | O=C(N/N=C\c1ccc(OCc2cccc3ccccc23)cc1)[C@@H](O)c1ccccc1 |
| InChI | InChI=1S/C26H22N2O3/c29-25(21-8-2-1-3-9-21)26(30)28-27-17-19-13-15-23(16-14-19)31-18-22-11-6-10-20-7-4-5-12-24(20)22/h1-17,25,29H,18H2,(H,28,30)/b27-17-/t25-/m0/s1 |
| InChIKey | ZGKCSBXNQMHBCE-RWJNZEQESA-N |
| XLogP | 4.60 |
| TPSA | 70.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.47 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|