C20H24N2O3 — CID 51671415
(2S)-2-hydroxy-N-[(E)-(4-pentoxyphenyl)methylideneamino]-2-phenylacetamide (PubChem CID 51671415) has the molecular formula C20H24N2O3 and a molecular weight of 340.42 g/mol. Its IUPAC name is (2S)-2-hydroxy-N-[(E)-(4-pentoxyphenyl)methylideneamino]-2-phenylacetamide.
| Compound Name | (2S)-2-hydroxy-N-[(E)-(4-pentoxyphenyl)methylideneamino]-2-phenylacetamide |
|---|---|
| PubChem CID | 51671415 |
| Molecular Formula | C20H24N2O3 |
| Molecular Weight | 340.42 g/mol |
| Exact Mass | 340.18 |
| IUPAC Name | (2S)-2-hydroxy-N-[(E)-(4-pentoxyphenyl)methylideneamino]-2-phenylacetamide |
| SMILES | CCCCCOc1ccc(/C=N/NC(=O)[C@@H](O)c2ccccc2)cc1 |
| InChI | InChI=1S/C20H24N2O3/c1-2-3-7-14-25-18-12-10-16(11-13-18)15-21-22-20(24)19(23)17-8-5-4-6-9-17/h4-6,8-13,15,19,23H,2-3,7,14H2,1H3,(H,22,24)/b21-15+/t19-/m0/s1 |
| InChIKey | UNMZIWKUEFMHFV-QTKYHAHDSA-N |
| XLogP | 3.44 |
| TPSA | 70.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.42 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|